C10H11NO2S — CID 838871
7-methoxy-4-methyl-1,4-benzothiazin-3-one (PubChem CID 838871) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 7-methoxy-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | 7-methoxy-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 838871 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 7-methoxy-4-methyl-1,4-benzothiazin-3-one |
| SMILES | COc1ccc2c(c1)SCC(=O)N2C |
| InChI | InChI=1S/C10H11NO2S/c1-11-8-4-3-7(13-2)5-9(8)14-6-10(11)12/h3-5H,6H2,1-2H3 |
| InChIKey | WOKMMBAQSMHGQU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |