C7H10ClN3O3 — CID 83889128
4-(1-amino-2-hydroxyethyl)-5-chloro-1-methylpyrazole-3-carboxylic acid (PubChem CID 83889128) has the molecular formula C7H10ClN3O3 and a molecular weight of 219.63 g/mol. Its IUPAC name is 4-(1-amino-2-hydroxyethyl)-5-chloro-1-methylpyrazole-3-carboxylic acid.
| Compound Name | 4-(1-amino-2-hydroxyethyl)-5-chloro-1-methylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 83889128 |
| Molecular Formula | C7H10ClN3O3 |
| Molecular Weight | 219.63 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 4-(1-amino-2-hydroxyethyl)-5-chloro-1-methylpyrazole-3-carboxylic acid |
| SMILES | Cn1nc(C(=O)O)c(C(N)CO)c1Cl |
| InChI | InChI=1S/C7H10ClN3O3/c1-11-6(8)4(3(9)2-12)5(10-11)7(13)14/h3,12H,2,9H2,1H3,(H,13,14) |
| InChIKey | ZINOXQQCFSYUAH-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.63 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |