C10H12N4O2 — CID 83889314
N-methyl-1-(3-methyl-1-nitroimidazo[1,5-a]pyridin-6-yl)methanamine (PubChem CID 83889314) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-methyl-1-(3-methyl-1-nitroimidazo[1,5-a]pyridin-6-yl)methanamine.
| Compound Name | N-methyl-1-(3-methyl-1-nitroimidazo[1,5-a]pyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 83889314 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-methyl-1-(3-methyl-1-nitroimidazo[1,5-a]pyridin-6-yl)methanamine |
| SMILES | CNCc1ccc2c([N+](=O)[O-])nc(C)n2c1 |
| InChI | InChI=1S/C10H12N4O2/c1-7-12-10(14(15)16)9-4-3-8(5-11-2)6-13(7)9/h3-4,6,11H,5H2,1-2H3 |
| InChIKey | RIEMWECOVIIVHW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|