C12H22N4 — CID 83890851
1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-1,4-diazepane (PubChem CID 83890851) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-1,4-diazepane.
| Compound Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 83890851 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-[(1-ethyl-3-methylpyrazol-4-yl)methyl]-1,4-diazepane |
| SMILES | CCn1cc(CN2CCCNCC2)c(C)n1 |
| InChI | InChI=1S/C12H22N4/c1-3-16-10-12(11(2)14-16)9-15-7-4-5-13-6-8-15/h10,13H,3-9H2,1-2H3 |
| InChIKey | NVBINGOIEKQFSF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |