2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid

C11H17N3O2 — CID 83891238

IUPAC2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid
SMILESCC(C)n1nnc2c1CCCC2CC(=O)O
InChIInChI=1S/C11H17N3O2/c1-7(2)14-9-5-3-4-8(6-10(15)16)11(9)12-13-14/h7-8H,3-6H2,1-2H3,(H,15,16)
InChIKeyMERUQVUGUWQQKF-UHFFFAOYSA-N
MW223.28 g/mol
LogP1.75
Rot. Bonds3

About 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid

2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid (PubChem CID 83891238) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid
PubChem CID83891238
Molecular FormulaC11H17N3O2
Molecular Weight223.28 g/mol
Exact Mass223.13
IUPAC Name2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid
SMILESCC(C)n1nnc2c1CCCC2CC(=O)O
InChIInChI=1S/C11H17N3O2/c1-7(2)14-9-5-3-4-8(6-10(15)16)11(9)12-13-14/h7-8H,3-6H2,1-2H3,(H,15,16)
InChIKeyMERUQVUGUWQQKF-UHFFFAOYSA-N
XLogP1.75
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.28
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid?
The IUPAC name of 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid (CID 83891238) is 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid.
What is the SMILES notation for 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid?
The canonical SMILES for 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid is CC(C)n1nnc2c1CCCC2CC(=O)O.
What is the InChIKey of 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid?
The InChIKey is MERUQVUGUWQQKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2/c1-7(2)14-9-5-3-4-8(6-10(15)16)11(9)12-13-14/h7-8H,3-6H2,1-2H3,(H,15,16).
What are the key properties of 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid?
2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid has a molecular weight of 223.28 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-propan-2-yl-4,5,6,7-tetrahydrobenzotriazol-4-yl)acetic acid is sourced from PubChem (CID 83891238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).