2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid

C8H11N3O2 — CID 83875712

IUPAC2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid
SMILESO=C(O)CC1CCCc2n[nH]nc21
InChIInChI=1S/C8H11N3O2/c12-7(13)4-5-2-1-3-6-8(5)10-11-9-6/h5H,1-4H2,(H,12,13)(H,9,10,11)
InChIKeyXKEWZLLYDMYVMO-UHFFFAOYSA-N
MW181.19 g/mol
LogP0.70
Rot. Bonds2

About 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid

2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid (PubChem CID 83875712) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid.

Molecular Properties

Compound Name2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid
PubChem CID83875712
Molecular FormulaC8H11N3O2
Molecular Weight181.19 g/mol
Exact Mass181.09
IUPAC Name2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid
SMILESO=C(O)CC1CCCc2n[nH]nc21
InChIInChI=1S/C8H11N3O2/c12-7(13)4-5-2-1-3-6-8(5)10-11-9-6/h5H,1-4H2,(H,12,13)(H,9,10,11)
InChIKeyXKEWZLLYDMYVMO-UHFFFAOYSA-N
XLogP0.70
TPSA78.87 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.19
LogP ≤ 50.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid?
The IUPAC name of 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid (CID 83875712) is 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid.
What is the SMILES notation for 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid?
The canonical SMILES for 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid is O=C(O)CC1CCCc2n[nH]nc21.
What is the InChIKey of 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid?
The InChIKey is XKEWZLLYDMYVMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c12-7(13)4-5-2-1-3-6-8(5)10-11-9-6/h5H,1-4H2,(H,12,13)(H,9,10,11).
What are the key properties of 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid?
2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid has a molecular weight of 181.19 g/mol, XLogP of 0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5,6,7-tetrahydro-2H-benzotriazol-4-yl)acetic acid is sourced from PubChem (CID 83875712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).