C11H16N4O2 — CID 166244619
N-cyclobutyloxy-4,5,6,7-tetrahydro-2H-benzotriazole-4-carboxamide (PubChem CID 166244619) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is N-cyclobutyloxy-4,5,6,7-tetrahydro-2H-benzotriazole-4-carboxamide.
| Compound Name | N-cyclobutyloxy-4,5,6,7-tetrahydro-2H-benzotriazole-4-carboxamide |
|---|---|
| PubChem CID | 166244619 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-cyclobutyloxy-4,5,6,7-tetrahydro-2H-benzotriazole-4-carboxamide |
| SMILES | O=C(NOC1CCC1)C1CCCc2n[nH]nc21 |
| InChI | InChI=1S/C11H16N4O2/c16-11(14-17-7-3-1-4-7)8-5-2-6-9-10(8)13-15-12-9/h7-8H,1-6H2,(H,14,16)(H,12,13,15) |
| InChIKey | ZOEFXXMRXYSEKP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|