C14H18N2O2 — CID 154862038
N-cyclobutyloxy-5,6,7,8-tetrahydroquinoline-8-carboxamide (PubChem CID 154862038) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-cyclobutyloxy-5,6,7,8-tetrahydroquinoline-8-carboxamide.
| Compound Name | N-cyclobutyloxy-5,6,7,8-tetrahydroquinoline-8-carboxamide |
|---|---|
| PubChem CID | 154862038 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-cyclobutyloxy-5,6,7,8-tetrahydroquinoline-8-carboxamide |
| SMILES | O=C(NOC1CCC1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C14H18N2O2/c17-14(16-18-11-6-2-7-11)12-8-1-4-10-5-3-9-15-13(10)12/h3,5,9,11-12H,1-2,4,6-8H2,(H,16,17) |
| InChIKey | OJLJEDRVOVUWBC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|