C12H20N2O4 — CID 142448490
N-cycloheptyloxy-4-hydroxy-2-oxopyrrolidine-3-carboxamide (PubChem CID 142448490) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is N-cycloheptyloxy-4-hydroxy-2-oxopyrrolidine-3-carboxamide.
| Compound Name | N-cycloheptyloxy-4-hydroxy-2-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 142448490 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-cycloheptyloxy-4-hydroxy-2-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1NCC(O)C1C(=O)NOC1CCCCCC1 |
| InChI | InChI=1S/C12H20N2O4/c15-9-7-13-11(16)10(9)12(17)14-18-8-5-3-1-2-4-6-8/h8-10,15H,1-7H2,(H,13,16)(H,14,17) |
| InChIKey | HGCYXBOSVJHAGB-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|