2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid

C10H15BrN2O2 — CID 83904320

IUPAC2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid
SMILESCc1c(C(C(=O)O)C(C)C)nn(C)c1Br
InChIInChI=1S/C10H15BrN2O2/c1-5(2)7(10(14)15)8-6(3)9(11)13(4)12-8/h5,7H,1-4H3,(H,14,15)
InChIKeyLRBBKDWJHVKBHG-UHFFFAOYSA-N
MW275.15 g/mol
LogP2.32
Rot. Bonds3

About 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid

2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid (PubChem CID 83904320) has the molecular formula C10H15BrN2O2 and a molecular weight of 275.15 g/mol. Its IUPAC name is 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid.

Molecular Properties

Compound Name2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid
PubChem CID83904320
Molecular FormulaC10H15BrN2O2
Molecular Weight275.15 g/mol
Exact Mass274.03
IUPAC Name2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid
SMILESCc1c(C(C(=O)O)C(C)C)nn(C)c1Br
InChIInChI=1S/C10H15BrN2O2/c1-5(2)7(10(14)15)8-6(3)9(11)13(4)12-8/h5,7H,1-4H3,(H,14,15)
InChIKeyLRBBKDWJHVKBHG-UHFFFAOYSA-N
XLogP2.32
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.15
LogP ≤ 52.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid?
The IUPAC name of 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid (CID 83904320) is 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid.
What is the SMILES notation for 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid?
The canonical SMILES for 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid is Cc1c(C(C(=O)O)C(C)C)nn(C)c1Br.
What is the InChIKey of 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid?
The InChIKey is LRBBKDWJHVKBHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrN2O2/c1-5(2)7(10(14)15)8-6(3)9(11)13(4)12-8/h5,7H,1-4H3,(H,14,15).
What are the key properties of 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid?
2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid has a molecular weight of 275.15 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1,4-dimethylpyrazol-3-yl)-3-methylbutanoic acid is sourced from PubChem (CID 83904320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).