C8H13NO — CID 83904881
(2R,6S)-2,6-dimethyloxane-4-carbonitrile (PubChem CID 83904881) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is (2R,6S)-2,6-dimethyloxane-4-carbonitrile.
| Compound Name | (2R,6S)-2,6-dimethyloxane-4-carbonitrile |
|---|---|
| PubChem CID | 83904881 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | (2R,6S)-2,6-dimethyloxane-4-carbonitrile |
| SMILES | C[C@@H]1CC(C#N)C[C@H](C)O1 |
| InChI | InChI=1S/C8H13NO/c1-6-3-8(5-9)4-7(2)10-6/h6-8H,3-4H2,1-2H3/t6-,7+,8? |
| InChIKey | AQIPGWQPFWJPAO-DHBOJHSNSA-N |
| XLogP | 1.71 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |