About 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid
4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid (PubChem CID 83905547) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid.
Analyze 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid?
The IUPAC name of 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid (CID 83905547) is 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid.
What is the SMILES notation for 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid?
The canonical SMILES for 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid is NC1(C(=O)O)CCc2[nH]ncc21.
What is the InChIKey of 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid?
The InChIKey is CAHSRHURHNVYLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c8-7(6(11)12)2-1-5-4(7)3-9-10-5/h3H,1-2,8H2,(H,9,10)(H,11,12).
What are the key properties of 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid?
4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid has a molecular weight of 167.17 g/mol, XLogP of -0.41, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid is sourced from PubChem (CID 83905547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).