C8H13N3O — CID 83905571
(7-amino-1,4,5,6-tetrahydroindazol-7-yl)methanol (PubChem CID 83905571) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is (7-amino-1,4,5,6-tetrahydroindazol-7-yl)methanol.
| Compound Name | (7-amino-1,4,5,6-tetrahydroindazol-7-yl)methanol |
|---|---|
| PubChem CID | 83905571 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (7-amino-1,4,5,6-tetrahydroindazol-7-yl)methanol |
| SMILES | NC1(CO)CCCc2cn[nH]c21 |
| InChI | InChI=1S/C8H13N3O/c9-8(5-12)3-1-2-6-4-10-11-7(6)8/h4,12H,1-3,5,9H2,(H,10,11) |
| InChIKey | YKWUVTZEWPFLKS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |