4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid

C7H8N2O3 — CID 83905660

IUPAC4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid
SMILESO=C(O)C1(O)CCc2[nH]ncc21
InChIInChI=1S/C7H8N2O3/c10-6(11)7(12)2-1-5-4(7)3-8-9-5/h3,12H,1-2H2,(H,8,9)(H,10,11)
InChIKeyAHICIJZCQFZZRZ-UHFFFAOYSA-N
MW168.15 g/mol
LogP-0.37
Rot. Bonds1

About 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid

4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid (PubChem CID 83905660) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid.

Molecular Properties

Compound Name4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid
PubChem CID83905660
Molecular FormulaC7H8N2O3
Molecular Weight168.15 g/mol
Exact Mass168.05
IUPAC Name4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid
SMILESO=C(O)C1(O)CCc2[nH]ncc21
InChIInChI=1S/C7H8N2O3/c10-6(11)7(12)2-1-5-4(7)3-8-9-5/h3,12H,1-2H2,(H,8,9)(H,10,11)
InChIKeyAHICIJZCQFZZRZ-UHFFFAOYSA-N
XLogP-0.37
TPSA86.21 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.15
LogP ≤ 5-0.37
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid?
The IUPAC name of 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid (CID 83905660) is 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid.
What is the SMILES notation for 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid?
The canonical SMILES for 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid is O=C(O)C1(O)CCc2[nH]ncc21.
What is the InChIKey of 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid?
The InChIKey is AHICIJZCQFZZRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c10-6(11)7(12)2-1-5-4(7)3-8-9-5/h3,12H,1-2H2,(H,8,9)(H,10,11).
What are the key properties of 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid?
4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid has a molecular weight of 168.15 g/mol, XLogP of -0.37, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5,6-dihydro-1H-cyclopenta[d]pyrazole-4-carboxylic acid is sourced from PubChem (CID 83905660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).