C10H20N2 — CID 83905689
6,8-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine (PubChem CID 83905689) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is 6,8-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine.
| Compound Name | 6,8-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine |
|---|---|
| PubChem CID | 83905689 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 6,8-dimethyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridine |
| SMILES | CC1CN(C)CC2CCCNC12 |
| InChI | InChI=1S/C10H20N2/c1-8-6-12(2)7-9-4-3-5-11-10(8)9/h8-11H,3-7H2,1-2H3 |
| InChIKey | PQMCJYUGLQUSCM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |