About 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid
2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid (PubChem CID 83906915) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid.
Analyze 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid?
The IUPAC name of 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid (CID 83906915) is 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid.
What is the SMILES notation for 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid?
The canonical SMILES for 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid is O=C(O)CC1(O)CC2CCCN2C1.
What is the InChIKey of 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid?
The InChIKey is QFUFVACKTKHXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c11-8(12)5-9(13)4-7-2-1-3-10(7)6-9/h7,13H,1-6H2,(H,11,12).
What are the key properties of 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid?
2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid has a molecular weight of 185.22 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxy-1,3,5,6,7,8-hexahydropyrrolizin-2-yl)acetic acid is sourced from PubChem (CID 83906915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).