About 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid
7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid (PubChem CID 83907940) has the molecular formula C10H9FO3
and a molecular weight of 196.18 g/mol. Its IUPAC name is 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid |
| PubChem CID | 83907940 |
| Molecular Formula | C10H9FO3 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid |
| SMILES | CC1Oc2c(F)cccc2C1C(=O)O |
| InChI | InChI=1S/C10H9FO3/c1-5-8(10(12)13)6-3-2-4-7(11)9(6)14-5/h2-5,8H,1H3,(H,12,13) |
| InChIKey | VNZQNXQOVAENDR-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid?
The IUPAC name of 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid (CID 83907940) is 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid.
What is the SMILES notation for 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid?
The canonical SMILES for 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid is CC1Oc2c(F)cccc2C1C(=O)O.
What is the InChIKey of 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid?
The InChIKey is VNZQNXQOVAENDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO3/c1-5-8(10(12)13)6-3-2-4-7(11)9(6)14-5/h2-5,8H,1H3,(H,12,13).
What are the key properties of 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid?
7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid has a molecular weight of 196.18 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2-methyl-2,3-dihydro-1-benzofuran-3-carboxylic acid is sourced from PubChem (CID 83907940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).