C12H14ClFO — CID 167223494
(2S)-3-(1-chloropropyl)-7-fluoro-2-methyl-2,3-dihydro-1-benzofuran (PubChem CID 167223494) has the molecular formula C12H14ClFO and a molecular weight of 228.69 g/mol. Its IUPAC name is (2S)-3-(1-chloropropyl)-7-fluoro-2-methyl-2,3-dihydro-1-benzofuran.
| Compound Name | (2S)-3-(1-chloropropyl)-7-fluoro-2-methyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 167223494 |
| Molecular Formula | C12H14ClFO |
| Molecular Weight | 228.69 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | (2S)-3-(1-chloropropyl)-7-fluoro-2-methyl-2,3-dihydro-1-benzofuran |
| SMILES | CCC(Cl)C1c2cccc(F)c2O[C@H]1C |
| InChI | InChI=1S/C12H14ClFO/c1-3-9(13)11-7(2)15-12-8(11)5-4-6-10(12)14/h4-7,9,11H,3H2,1-2H3/t7-,9?,11?/m0/s1 |
| InChIKey | HJPKWGOCBUEOOJ-DSXZHNHRSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.69 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|