C12H10ClFO — CID 167223164
1-chloro-6-fluoro-1,2,4a,9b-tetrahydrodibenzofuran (PubChem CID 167223164) has the molecular formula C12H10ClFO and a molecular weight of 224.66 g/mol. Its IUPAC name is 1-chloro-6-fluoro-1,2,4a,9b-tetrahydrodibenzofuran.
| Compound Name | 1-chloro-6-fluoro-1,2,4a,9b-tetrahydrodibenzofuran |
|---|---|
| PubChem CID | 167223164 |
| Molecular Formula | C12H10ClFO |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 1-chloro-6-fluoro-1,2,4a,9b-tetrahydrodibenzofuran |
| SMILES | Fc1cccc2c1OC1C=CCC(Cl)C21 |
| InChI | InChI=1S/C12H10ClFO/c13-8-4-2-6-10-11(8)7-3-1-5-9(14)12(7)15-10/h1-3,5-6,8,10-11H,4H2 |
| InChIKey | RMPXXIWWIMXZRP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|