C16H11ClFNO2 — CID 132518610
(2R,3S)-3-chloro-7-fluoro-2'-phenylspiro[3H-1-benzofuran-2,5'-4H-1,3-oxazole] (PubChem CID 132518610) has the molecular formula C16H11ClFNO2 and a molecular weight of 303.72 g/mol. Its IUPAC name is (2R,3S)-3-chloro-7-fluoro-2'-phenylspiro[3H-1-benzofuran-2,5'-4H-1,3-oxazole].
| Compound Name | (2R,3S)-3-chloro-7-fluoro-2'-phenylspiro[3H-1-benzofuran-2,5'-4H-1,3-oxazole] |
|---|---|
| PubChem CID | 132518610 |
| Molecular Formula | C16H11ClFNO2 |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (2R,3S)-3-chloro-7-fluoro-2'-phenylspiro[3H-1-benzofuran-2,5'-4H-1,3-oxazole] |
| SMILES | Fc1cccc2c1O[C@@]1(CN=C(c3ccccc3)O1)[C@H]2Cl |
| InChI | InChI=1S/C16H11ClFNO2/c17-14-11-7-4-8-12(18)13(11)20-16(14)9-19-15(21-16)10-5-2-1-3-6-10/h1-8,14H,9H2/t14-,16+/m0/s1 |
| InChIKey | YWUXSNCPQJZQBV-GOEBONIOSA-N |
| XLogP | 3.67 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|