C17H14F3NO — CID 132602176
2,5-diphenyl-5-(2,2,2-trifluoroethyl)-4H-1,3-oxazole (PubChem CID 132602176) has the molecular formula C17H14F3NO and a molecular weight of 305.30 g/mol. Its IUPAC name is 2,5-diphenyl-5-(2,2,2-trifluoroethyl)-4H-1,3-oxazole.
| Compound Name | 2,5-diphenyl-5-(2,2,2-trifluoroethyl)-4H-1,3-oxazole |
|---|---|
| PubChem CID | 132602176 |
| Molecular Formula | C17H14F3NO |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2,5-diphenyl-5-(2,2,2-trifluoroethyl)-4H-1,3-oxazole |
| SMILES | FC(F)(F)CC1(c2ccccc2)CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C17H14F3NO/c18-17(19,20)11-16(14-9-5-2-6-10-14)12-21-15(22-16)13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | QQJNYAKHNVPLNE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |