C18H15FO — CID 132849770
(3aR,9R,9aR)-9-(4-fluorophenyl)-1,3a,9,9a-tetrahydrocyclopenta[b]chromene (PubChem CID 132849770) has the molecular formula C18H15FO and a molecular weight of 266.32 g/mol. Its IUPAC name is (3aR,9R,9aR)-9-(4-fluorophenyl)-1,3a,9,9a-tetrahydrocyclopenta[b]chromene.
| Compound Name | (3aR,9R,9aR)-9-(4-fluorophenyl)-1,3a,9,9a-tetrahydrocyclopenta[b]chromene |
|---|---|
| PubChem CID | 132849770 |
| Molecular Formula | C18H15FO |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3aR,9R,9aR)-9-(4-fluorophenyl)-1,3a,9,9a-tetrahydrocyclopenta[b]chromene |
| SMILES | Fc1ccc([C@@H]2c3ccccc3O[C@@H]3C=CC[C@H]23)cc1 |
| InChI | InChI=1S/C18H15FO/c19-13-10-8-12(9-11-13)18-14-4-1-2-6-16(14)20-17-7-3-5-15(17)18/h1-4,6-11,15,17-18H,5H2/t15-,17+,18+/m0/s1 |
| InChIKey | CANZRTOVYSMFNF-CGTJXYLNSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|