C20H13Cl2FOS — CID 98065115
(1aR,7S,7aS)-1,1-dichloro-7-(4-fluorophenyl)-1a-thiophen-2-yl-7,7a-dihydrocyclopropa[b]chromene (PubChem CID 98065115) has the molecular formula C20H13Cl2FOS and a molecular weight of 391.29 g/mol. Its IUPAC name is (1aR,7S,7aS)-1,1-dichloro-7-(4-fluorophenyl)-1a-thiophen-2-yl-7,7a-dihydrocyclopropa[b]chromene.
| Compound Name | (1aR,7S,7aS)-1,1-dichloro-7-(4-fluorophenyl)-1a-thiophen-2-yl-7,7a-dihydrocyclopropa[b]chromene |
|---|---|
| PubChem CID | 98065115 |
| Molecular Formula | C20H13Cl2FOS |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | (1aR,7S,7aS)-1,1-dichloro-7-(4-fluorophenyl)-1a-thiophen-2-yl-7,7a-dihydrocyclopropa[b]chromene |
| SMILES | Fc1ccc([C@H]2c3ccccc3O[C@@]3(c4cccs4)[C@H]2C3(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H13Cl2FOS/c21-20(22)18-17(12-7-9-13(23)10-8-12)14-4-1-2-5-15(14)24-19(18,20)16-6-3-11-25-16/h1-11,17-18H/t17-,18-,19-/m0/s1 |
| InChIKey | PALWPSFPQWNCGL-FHWLQOOXSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|