C21H16Cl2OS — CID 26525977
(1aS,7S,7aS)-1,1-dichloro-7a-methyl-7-phenyl-1a-thiophen-2-yl-7H-cyclopropa[b]chromene (PubChem CID 26525977) has the molecular formula C21H16Cl2OS and a molecular weight of 387.33 g/mol. Its IUPAC name is (1aS,7S,7aS)-1,1-dichloro-7a-methyl-7-phenyl-1a-thiophen-2-yl-7H-cyclopropa[b]chromene.
| Compound Name | (1aS,7S,7aS)-1,1-dichloro-7a-methyl-7-phenyl-1a-thiophen-2-yl-7H-cyclopropa[b]chromene |
|---|---|
| PubChem CID | 26525977 |
| Molecular Formula | C21H16Cl2OS |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (1aS,7S,7aS)-1,1-dichloro-7a-methyl-7-phenyl-1a-thiophen-2-yl-7H-cyclopropa[b]chromene |
| SMILES | C[C@]12[C@@H](c3ccccc3)c3ccccc3O[C@@]1(c1cccs1)C2(Cl)Cl |
| InChI | InChI=1S/C21H16Cl2OS/c1-19-18(14-8-3-2-4-9-14)15-10-5-6-11-16(15)24-20(19,21(19,22)23)17-12-7-13-25-17/h2-13,18H,1H3/t18-,19-,20+/m0/s1 |
| InChIKey | UZBXZHWLMVYTGC-SLFFLAALSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|