C24H19Cl2FO2 — CID 98133784
(1aR,7S,7aS)-1,1-dichloro-1a-(4-ethoxyphenyl)-7-(4-fluorophenyl)-7,7a-dihydrocyclopropa[b]chromene (PubChem CID 98133784) has the molecular formula C24H19Cl2FO2 and a molecular weight of 429.32 g/mol. Its IUPAC name is (1aR,7S,7aS)-1,1-dichloro-1a-(4-ethoxyphenyl)-7-(4-fluorophenyl)-7,7a-dihydrocyclopropa[b]chromene.
| Compound Name | (1aR,7S,7aS)-1,1-dichloro-1a-(4-ethoxyphenyl)-7-(4-fluorophenyl)-7,7a-dihydrocyclopropa[b]chromene |
|---|---|
| PubChem CID | 98133784 |
| Molecular Formula | C24H19Cl2FO2 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (1aR,7S,7aS)-1,1-dichloro-1a-(4-ethoxyphenyl)-7-(4-fluorophenyl)-7,7a-dihydrocyclopropa[b]chromene |
| SMILES | CCOc1ccc([C@]23Oc4ccccc4[C@H](c4ccc(F)cc4)[C@@H]2C3(Cl)Cl)cc1 |
| InChI | InChI=1S/C24H19Cl2FO2/c1-2-28-18-13-9-16(10-14-18)23-22(24(23,25)26)21(15-7-11-17(27)12-8-15)19-5-3-4-6-20(19)29-23/h3-14,21-22H,2H2,1H3/t21-,22-,23-/m0/s1 |
| InChIKey | JQJMUQPBYFANTJ-VABKMULXSA-N |
| XLogP | 6.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|