4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid

C10H15N3O2 — CID 83909321

IUPAC4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid
SMILESCc1c2c(nn1C)CCCC2(N)C(=O)O
InChIInChI=1S/C10H15N3O2/c1-6-8-7(12-13(6)2)4-3-5-10(8,11)9(14)15/h3-5,11H2,1-2H3,(H,14,15)
InChIKeyXKBGVUVTHZKVNI-UHFFFAOYSA-N
MW209.25 g/mol
LogP0.30
Rot. Bonds1

About 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid

4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid (PubChem CID 83909321) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid.

Molecular Properties

Compound Name4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid
PubChem CID83909321
Molecular FormulaC10H15N3O2
Molecular Weight209.25 g/mol
Exact Mass209.12
IUPAC Name4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid
SMILESCc1c2c(nn1C)CCCC2(N)C(=O)O
InChIInChI=1S/C10H15N3O2/c1-6-8-7(12-13(6)2)4-3-5-10(8,11)9(14)15/h3-5,11H2,1-2H3,(H,14,15)
InChIKeyXKBGVUVTHZKVNI-UHFFFAOYSA-N
XLogP0.30
TPSA81.14 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.25
LogP ≤ 50.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The IUPAC name of 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid (CID 83909321) is 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid.
What is the SMILES notation for 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The canonical SMILES for 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid is Cc1c2c(nn1C)CCCC2(N)C(=O)O.
What is the InChIKey of 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
The InChIKey is XKBGVUVTHZKVNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2/c1-6-8-7(12-13(6)2)4-3-5-10(8,11)9(14)15/h3-5,11H2,1-2H3,(H,14,15).
What are the key properties of 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid?
4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid has a molecular weight of 209.25 g/mol, XLogP of 0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,3-dimethyl-6,7-dihydro-5H-indazole-4-carboxylic acid is sourced from PubChem (CID 83909321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).