About 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid
2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid (PubChem CID 83909526) has the molecular formula C10H14N2O3
and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid.
Analyze 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid?
The IUPAC name of 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid (CID 83909526) is 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid.
What is the SMILES notation for 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid?
The canonical SMILES for 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid is Cn1ncc2c1C(O)(CC(=O)O)CCC2.
What is the InChIKey of 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid?
The InChIKey is LSAAUPAQIHILAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3/c1-12-9-7(6-11-12)3-2-4-10(9,15)5-8(13)14/h6,15H,2-5H2,1H3,(H,13,14).
What are the key properties of 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid?
2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid has a molecular weight of 210.23 g/mol, XLogP of 0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-hydroxy-1-methyl-5,6-dihydro-4H-indazol-7-yl)acetic acid is sourced from PubChem (CID 83909526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).