About 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid
7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid (PubChem CID 82399795) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid.
Analyze 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid?
The IUPAC name of 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid (CID 82399795) is 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid.
What is the SMILES notation for 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid?
The canonical SMILES for 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid is Cn1cc2c(n1)C(O)(C(=O)O)CCC2.
What is the InChIKey of 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid?
The InChIKey is YQZGCVXARUUELF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-11-5-6-3-2-4-9(14,8(12)13)7(6)10-11/h5,14H,2-4H2,1H3,(H,12,13).
What are the key properties of 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid?
7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid has a molecular weight of 196.21 g/mol, XLogP of 0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-2-methyl-5,6-dihydro-4H-indazole-7-carboxylic acid is sourced from PubChem (CID 82399795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).