C11H17NO3 — CID 83909620
2-(3-amino-4-hydroxybutan-2-yl)-6-methoxyphenol (PubChem CID 83909620) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-(3-amino-4-hydroxybutan-2-yl)-6-methoxyphenol.
| Compound Name | 2-(3-amino-4-hydroxybutan-2-yl)-6-methoxyphenol |
|---|---|
| PubChem CID | 83909620 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-(3-amino-4-hydroxybutan-2-yl)-6-methoxyphenol |
| SMILES | COc1cccc(C(C)C(N)CO)c1O |
| InChI | InChI=1S/C11H17NO3/c1-7(9(12)6-13)8-4-3-5-10(15-2)11(8)14/h3-5,7,9,13-14H,6,12H2,1-2H3 |
| InChIKey | YZQCBBPYPGZCNX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |