C9H6ClFN2S — CID 83911404
4-chloro-3-(3-fluorophenyl)-1,2-thiazol-5-amine (PubChem CID 83911404) has the molecular formula C9H6ClFN2S and a molecular weight of 228.68 g/mol. Its IUPAC name is 4-chloro-3-(3-fluorophenyl)-1,2-thiazol-5-amine.
| Compound Name | 4-chloro-3-(3-fluorophenyl)-1,2-thiazol-5-amine |
|---|---|
| PubChem CID | 83911404 |
| Molecular Formula | C9H6ClFN2S |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 4-chloro-3-(3-fluorophenyl)-1,2-thiazol-5-amine |
| SMILES | Nc1snc(-c2cccc(F)c2)c1Cl |
| InChI | InChI=1S/C9H6ClFN2S/c10-7-8(13-14-9(7)12)5-2-1-3-6(11)4-5/h1-4H,12H2 |
| InChIKey | SWNADINUVWHYGL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |