C8H14BrN3 — CID 83911696
4-bromo-1-methyl-5-(2-methylpropyl)pyrazol-3-amine (PubChem CID 83911696) has the molecular formula C8H14BrN3 and a molecular weight of 232.12 g/mol. Its IUPAC name is 4-bromo-1-methyl-5-(2-methylpropyl)pyrazol-3-amine.
| Compound Name | 4-bromo-1-methyl-5-(2-methylpropyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 83911696 |
| Molecular Formula | C8H14BrN3 |
| Molecular Weight | 232.12 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 4-bromo-1-methyl-5-(2-methylpropyl)pyrazol-3-amine |
| SMILES | CC(C)Cc1c(Br)c(N)nn1C |
| InChI | InChI=1S/C8H14BrN3/c1-5(2)4-6-7(9)8(10)11-12(6)3/h5H,4H2,1-3H3,(H2,10,11) |
| InChIKey | NAZDDGQOQACDRD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.12 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |