About 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid
2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid (PubChem CID 83912173) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid.
Analyze 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid?
The IUPAC name of 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid (CID 83912173) is 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid.
What is the SMILES notation for 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid?
The canonical SMILES for 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid is COc1cccc2c1OCCC2C(N)C(=O)O.
What is the InChIKey of 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid?
The InChIKey is OXPZXMYQYPESQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-16-9-4-2-3-8-7(10(13)12(14)15)5-6-17-11(8)9/h2-4,7,10H,5-6,13H2,1H3,(H,14,15).
What are the key properties of 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid?
2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid has a molecular weight of 237.25 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(8-methoxy-3,4-dihydro-2H-chromen-4-yl)acetic acid is sourced from PubChem (CID 83912173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).