3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid

C9H11BrN2O2 — CID 83913286

IUPAC3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
SMILESCn1nc(Br)c2c1CCCC2C(=O)O
InChIInChI=1S/C9H11BrN2O2/c1-12-6-4-2-3-5(9(13)14)7(6)8(10)11-12/h5H,2-4H2,1H3,(H,13,14)
InChIKeyYAXQQLUUJRTKBP-UHFFFAOYSA-N
MW259.10 g/mol
LogP1.69
Rot. Bonds1

About 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid

3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (PubChem CID 83913286) has the molecular formula C9H11BrN2O2 and a molecular weight of 259.10 g/mol. Its IUPAC name is 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.

Molecular Properties

Compound Name3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
PubChem CID83913286
Molecular FormulaC9H11BrN2O2
Molecular Weight259.10 g/mol
Exact Mass258.00
IUPAC Name3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid
SMILESCn1nc(Br)c2c1CCCC2C(=O)O
InChIInChI=1S/C9H11BrN2O2/c1-12-6-4-2-3-5(9(13)14)7(6)8(10)11-12/h5H,2-4H2,1H3,(H,13,14)
InChIKeyYAXQQLUUJRTKBP-UHFFFAOYSA-N
XLogP1.69
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.10
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The IUPAC name of 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid (CID 83913286) is 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid.
What is the SMILES notation for 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The canonical SMILES for 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is Cn1nc(Br)c2c1CCCC2C(=O)O.
What is the InChIKey of 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
The InChIKey is YAXQQLUUJRTKBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrN2O2/c1-12-6-4-2-3-5(9(13)14)7(6)8(10)11-12/h5H,2-4H2,1H3,(H,13,14).
What are the key properties of 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid?
3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid has a molecular weight of 259.10 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylic acid is sourced from PubChem (CID 83913286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).