C9H11N2O2- — CID 131737191
1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylate (PubChem CID 131737191) has the molecular formula C9H11N2O2- and a molecular weight of 179.20 g/mol. Its IUPAC name is 1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylate.
| Compound Name | 1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylate |
|---|---|
| PubChem CID | 131737191 |
| Molecular Formula | C9H11N2O2- |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 1-methyl-4,5,6,7-tetrahydroindazole-4-carboxylate |
| SMILES | Cn1ncc2c1CCCC2C(=O)[O-] |
| InChI | InChI=1S/C9H12N2O2/c1-11-8-4-2-3-6(9(12)13)7(8)5-10-11/h5-6H,2-4H2,1H3,(H,12,13)/p-1 |
| InChIKey | OCAXSYCKYKWEFD-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |