C11H12BrN3 — CID 83913416
4-bromo-5-(3,5-dimethylphenyl)-1H-pyrazol-3-amine (PubChem CID 83913416) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is 4-bromo-5-(3,5-dimethylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 4-bromo-5-(3,5-dimethylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 83913416 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 4-bromo-5-(3,5-dimethylphenyl)-1H-pyrazol-3-amine |
| SMILES | Cc1cc(C)cc(-c2[nH]nc(N)c2Br)c1 |
| InChI | InChI=1S/C11H12BrN3/c1-6-3-7(2)5-8(4-6)10-9(12)11(13)15-14-10/h3-5H,1-2H3,(H3,13,14,15) |
| InChIKey | WCYVCCMWZQXDLF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |