C11H12BrN3O2S — CID 84608772
4-bromo-5-(4-ethylsulfonylphenyl)-1H-pyrazol-3-amine (PubChem CID 84608772) has the molecular formula C11H12BrN3O2S and a molecular weight of 330.21 g/mol. Its IUPAC name is 4-bromo-5-(4-ethylsulfonylphenyl)-1H-pyrazol-3-amine.
| Compound Name | 4-bromo-5-(4-ethylsulfonylphenyl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 84608772 |
| Molecular Formula | C11H12BrN3O2S |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 4-bromo-5-(4-ethylsulfonylphenyl)-1H-pyrazol-3-amine |
| SMILES | CCS(=O)(=O)c1ccc(-c2[nH]nc(N)c2Br)cc1 |
| InChI | InChI=1S/C11H12BrN3O2S/c1-2-18(16,17)8-5-3-7(4-6-8)10-9(12)11(13)15-14-10/h3-6H,2H2,1H3,(H3,13,14,15) |
| InChIKey | YGKYSQCFVKQPQY-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |