C11H18ClNO3S — CID 166644481
3-amino-3-(4-ethylsulfonylphenyl)propan-1-ol;hydrochloride (PubChem CID 166644481) has the molecular formula C11H18ClNO3S and a molecular weight of 279.79 g/mol. Its IUPAC name is 3-amino-3-(4-ethylsulfonylphenyl)propan-1-ol;hydrochloride.
| Compound Name | 3-amino-3-(4-ethylsulfonylphenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 166644481 |
| Molecular Formula | C11H18ClNO3S |
| Molecular Weight | 279.79 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-amino-3-(4-ethylsulfonylphenyl)propan-1-ol;hydrochloride |
| SMILES | CCS(=O)(=O)c1ccc(C(N)CCO)cc1.Cl |
| InChI | InChI=1S/C11H17NO3S.ClH/c1-2-16(14,15)10-5-3-9(4-6-10)11(12)7-8-13;/h3-6,11,13H,2,7-8,12H2,1H3;1H |
| InChIKey | YFOWYLRVPRYJSE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.79 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |