C11H17ClN2O4S — CID 166644392
[(2R)-2-amino-2-(4-ethylsulfonylphenyl)ethyl] carbamate;hydrochloride (PubChem CID 166644392) has the molecular formula C11H17ClN2O4S and a molecular weight of 308.79 g/mol. Its IUPAC name is [(2R)-2-amino-2-(4-ethylsulfonylphenyl)ethyl] carbamate;hydrochloride.
| Compound Name | [(2R)-2-amino-2-(4-ethylsulfonylphenyl)ethyl] carbamate;hydrochloride |
|---|---|
| PubChem CID | 166644392 |
| Molecular Formula | C11H17ClN2O4S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | [(2R)-2-amino-2-(4-ethylsulfonylphenyl)ethyl] carbamate;hydrochloride |
| SMILES | CCS(=O)(=O)c1ccc([C@@H](N)COC(N)=O)cc1.Cl |
| InChI | InChI=1S/C11H16N2O4S.ClH/c1-2-18(15,16)9-5-3-8(4-6-9)10(12)7-17-11(13)14;/h3-6,10H,2,7,12H2,1H3,(H2,13,14);1H/t10-;/m0./s1 |
| InChIKey | VJXCNFJHSDDCEX-PPHPATTJSA-N |
| XLogP | 1.00 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |