C12H14N2O4S — CID 175151348
[(1S)-2-cyano-1-(4-ethylsulfonylphenyl)ethyl] carbamate (PubChem CID 175151348) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is [(1S)-2-cyano-1-(4-ethylsulfonylphenyl)ethyl] carbamate.
| Compound Name | [(1S)-2-cyano-1-(4-ethylsulfonylphenyl)ethyl] carbamate |
|---|---|
| PubChem CID | 175151348 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [(1S)-2-cyano-1-(4-ethylsulfonylphenyl)ethyl] carbamate |
| SMILES | CCS(=O)(=O)c1ccc([C@H](CC#N)OC(N)=O)cc1 |
| InChI | InChI=1S/C12H14N2O4S/c1-2-19(16,17)10-5-3-9(4-6-10)11(7-8-13)18-12(14)15/h3-6,11H,2,7H2,1H3,(H2,14,15)/t11-/m0/s1 |
| InChIKey | DWBLULUWYKWTNJ-NSHDSACASA-N |
| XLogP | 1.53 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |