C10H14ClN3O2S — CID 156774026
(3S)-3-amino-3-(5-ethylsulfonyl-2-pyridinyl)propanenitrile;hydrochloride (PubChem CID 156774026) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is (3S)-3-amino-3-(5-ethylsulfonyl-2-pyridinyl)propanenitrile;hydrochloride.
| Compound Name | (3S)-3-amino-3-(5-ethylsulfonyl-2-pyridinyl)propanenitrile;hydrochloride |
|---|---|
| PubChem CID | 156774026 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (3S)-3-amino-3-(5-ethylsulfonyl-2-pyridinyl)propanenitrile;hydrochloride |
| SMILES | CCS(=O)(=O)c1ccc([C@@H](N)CC#N)nc1.Cl |
| InChI | InChI=1S/C10H13N3O2S.ClH/c1-2-16(14,15)8-3-4-10(13-7-8)9(12)5-6-11;/h3-4,7,9H,2,5,12H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | DAKROFMGRNJPKV-FVGYRXGTSA-N |
| XLogP | 1.21 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |