C8H9N3O3S — CID 63214990
6-(1-cyano-2-hydroxyethyl)pyridine-3-sulfonamide (PubChem CID 63214990) has the molecular formula C8H9N3O3S and a molecular weight of 227.25 g/mol. Its IUPAC name is 6-(1-cyano-2-hydroxyethyl)pyridine-3-sulfonamide.
| Compound Name | 6-(1-cyano-2-hydroxyethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63214990 |
| Molecular Formula | C8H9N3O3S |
| Molecular Weight | 227.25 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 6-(1-cyano-2-hydroxyethyl)pyridine-3-sulfonamide |
| SMILES | N#CC(CO)c1ccc(S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C8H9N3O3S/c9-3-6(5-12)8-2-1-7(4-11-8)15(10,13)14/h1-2,4,6,12H,5H2,(H2,10,13,14) |
| InChIKey | ZUBKVPYQTNINAG-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 117.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.25 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |