C12H17N3O5S — CID 175360295
[(1R)-2-(carbamoylamino)-1-(4-ethylsulfonylphenyl)ethyl] carbamate (PubChem CID 175360295) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is [(1R)-2-(carbamoylamino)-1-(4-ethylsulfonylphenyl)ethyl] carbamate.
| Compound Name | [(1R)-2-(carbamoylamino)-1-(4-ethylsulfonylphenyl)ethyl] carbamate |
|---|---|
| PubChem CID | 175360295 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [(1R)-2-(carbamoylamino)-1-(4-ethylsulfonylphenyl)ethyl] carbamate |
| SMILES | CCS(=O)(=O)c1ccc([C@H](CNC(N)=O)OC(N)=O)cc1 |
| InChI | InChI=1S/C12H17N3O5S/c1-2-21(18,19)9-5-3-8(4-6-9)10(20-12(14)17)7-15-11(13)16/h3-6,10H,2,7H2,1H3,(H2,14,17)(H3,13,15,16)/t10-/m0/s1 |
| InChIKey | JVLUUUSVIGVLGH-JTQLQIEISA-N |
| XLogP | 0.28 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |