C11H14N4O2S — CID 82487034
[3-(4-ethylsulfonylphenyl)-1H-1,2,4-triazol-5-yl]methanamine (PubChem CID 82487034) has the molecular formula C11H14N4O2S and a molecular weight of 266.33 g/mol. Its IUPAC name is [3-(4-ethylsulfonylphenyl)-1H-1,2,4-triazol-5-yl]methanamine.
| Compound Name | [3-(4-ethylsulfonylphenyl)-1H-1,2,4-triazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82487034 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | [3-(4-ethylsulfonylphenyl)-1H-1,2,4-triazol-5-yl]methanamine |
| SMILES | CCS(=O)(=O)c1ccc(-c2n[nH]c(CN)n2)cc1 |
| InChI | InChI=1S/C11H14N4O2S/c1-2-18(16,17)9-5-3-8(4-6-9)11-13-10(7-12)14-15-11/h3-6H,2,7,12H2,1H3,(H,13,14,15) |
| InChIKey | WICPFUIADOARHY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |