C11H20N2O2 — CID 83916937
1,7-dimethyl-2,3,4,4a,5,6,8,8a-octahydro-1,7-naphthyridine-4-carboxylic acid (PubChem CID 83916937) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 1,7-dimethyl-2,3,4,4a,5,6,8,8a-octahydro-1,7-naphthyridine-4-carboxylic acid.
| Compound Name | 1,7-dimethyl-2,3,4,4a,5,6,8,8a-octahydro-1,7-naphthyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 83916937 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 1,7-dimethyl-2,3,4,4a,5,6,8,8a-octahydro-1,7-naphthyridine-4-carboxylic acid |
| SMILES | CN1CCC2C(C(=O)O)CCN(C)C2C1 |
| InChI | InChI=1S/C11H20N2O2/c1-12-5-3-8-9(11(14)15)4-6-13(2)10(8)7-12/h8-10H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | UAOVUTVQYWDKFL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |