C9H17F3N2O — CID 83918073
4-(aminomethyl)-1-(2,2,2-trifluoroethyl)azepan-4-ol (PubChem CID 83918073) has the molecular formula C9H17F3N2O and a molecular weight of 226.24 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(2,2,2-trifluoroethyl)azepan-4-ol.
| Compound Name | 4-(aminomethyl)-1-(2,2,2-trifluoroethyl)azepan-4-ol |
|---|---|
| PubChem CID | 83918073 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 4-(aminomethyl)-1-(2,2,2-trifluoroethyl)azepan-4-ol |
| SMILES | NCC1(O)CCCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N2O/c10-9(11,12)7-14-4-1-2-8(15,6-13)3-5-14/h15H,1-7,13H2 |
| InChIKey | DQXBSXQHAOUHBU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |