C10H19F3N2O — CID 83919438
4-(2-aminoethyl)-1-(2,2,2-trifluoroethyl)azepan-4-ol (PubChem CID 83919438) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 4-(2-aminoethyl)-1-(2,2,2-trifluoroethyl)azepan-4-ol.
| Compound Name | 4-(2-aminoethyl)-1-(2,2,2-trifluoroethyl)azepan-4-ol |
|---|---|
| PubChem CID | 83919438 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-(2-aminoethyl)-1-(2,2,2-trifluoroethyl)azepan-4-ol |
| SMILES | NCCC1(O)CCCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H19F3N2O/c11-10(12,13)8-15-6-1-2-9(16,3-5-14)4-7-15/h16H,1-8,14H2 |
| InChIKey | DOPFRASYHSIENQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |