C16H24N2O — CID 83920140
(6-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-4-yl)methanol (PubChem CID 83920140) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is (6-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-4-yl)methanol.
| Compound Name | (6-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-4-yl)methanol |
|---|---|
| PubChem CID | 83920140 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | (6-benzyl-2,3,4,4a,5,7,8,8a-octahydro-1H-1,6-naphthyridin-4-yl)methanol |
| SMILES | OCC1CCNC2CCN(Cc3ccccc3)CC12 |
| InChI | InChI=1S/C16H24N2O/c19-12-14-6-8-17-16-7-9-18(11-15(14)16)10-13-4-2-1-3-5-13/h1-5,14-17,19H,6-12H2 |
| InChIKey | YHZDQHBKHXPLGX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |