C16H15N3O — CID 83920247
2-benzyl-5-isocyanato-3,4-dihydro-1H-2,7-naphthyridine (PubChem CID 83920247) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-benzyl-5-isocyanato-3,4-dihydro-1H-2,7-naphthyridine.
| Compound Name | 2-benzyl-5-isocyanato-3,4-dihydro-1H-2,7-naphthyridine |
|---|---|
| PubChem CID | 83920247 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-benzyl-5-isocyanato-3,4-dihydro-1H-2,7-naphthyridine |
| SMILES | O=C=Nc1cncc2c1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C16H15N3O/c20-12-18-16-9-17-8-14-11-19(7-6-15(14)16)10-13-4-2-1-3-5-13/h1-5,8-9H,6-7,10-11H2 |
| InChIKey | QPCJSGCUUFYIGP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|