C16H21BrO2 — CID 83921729
methyl 2-[2-(3-bromo-4-ethylphenyl)propyl]cyclopropane-1-carboxylate (PubChem CID 83921729) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is methyl 2-[2-(3-bromo-4-ethylphenyl)propyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 2-[2-(3-bromo-4-ethylphenyl)propyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 83921729 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | methyl 2-[2-(3-bromo-4-ethylphenyl)propyl]cyclopropane-1-carboxylate |
| SMILES | CCc1ccc(C(C)CC2CC2C(=O)OC)cc1Br |
| InChI | InChI=1S/C16H21BrO2/c1-4-11-5-6-12(9-15(11)17)10(2)7-13-8-14(13)16(18)19-3/h5-6,9-10,13-14H,4,7-8H2,1-3H3 |
| InChIKey | RJTMCGNXPDHOSB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |