C16H22O4S — CID 83927264
methyl 2-[2-(4-ethylsulfonylphenyl)propyl]cyclopropane-1-carboxylate (PubChem CID 83927264) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is methyl 2-[2-(4-ethylsulfonylphenyl)propyl]cyclopropane-1-carboxylate.
| Compound Name | methyl 2-[2-(4-ethylsulfonylphenyl)propyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 83927264 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | methyl 2-[2-(4-ethylsulfonylphenyl)propyl]cyclopropane-1-carboxylate |
| SMILES | CCS(=O)(=O)c1ccc(C(C)CC2CC2C(=O)OC)cc1 |
| InChI | InChI=1S/C16H22O4S/c1-4-21(18,19)14-7-5-12(6-8-14)11(2)9-13-10-15(13)16(17)20-3/h5-8,11,13,15H,4,9-10H2,1-3H3 |
| InChIKey | BDPZXNRNMZZJGG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |